Products 116834-08-3

CAS 116834-08-3 is the registry number for 1-Phenyl-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 116834-08-3) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: UOWVLCHBFVAAQI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11N3O2
Molecular weight253.26 g/mol
IUPAC name1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxylic acid
InChIKeyUOWVLCHBFVAAQI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)N3C=CC=C3

Computed by PubChem (NCBI)