CAS 220143-28-2 appears in our catalog under these names: 1-Benzyl-1,2,3-benzotriazole-5-carboxylic acid, 98%, 1-Benzyl-1,2,3-benzotriazole-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg.
1-benzylbenzotriazole-5-carboxylic acid (CAS 220143-28-2) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 1-benzylbenzotriazole-5-carboxylic acid. InChIKey: DYDCPTUTFGJNQT-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 1-benzylbenzotriazole-5-carboxylic acid |
| InChIKey | DYDCPTUTFGJNQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)C(=O)O)N=N2 |
Computed by PubChem (NCBI)