CAS 1185287-60-8 appears in our catalog under these names: 1-Benzyl-1h-pyrazolo[3,4-b]pyridine-3-carboxylic acid, 95%, 1-Benzyl-1H-pyrazolo(3,4-b)pyridine-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-benzylpyrazolo[5,4-b]pyridine-3-carboxylic acid (CAS 1185287-60-8) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 1-benzylpyrazolo[5,4-b]pyridine-3-carboxylic acid. InChIKey: QLDNIXIDTPFIOV-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 1-benzylpyrazolo[5,4-b]pyridine-3-carboxylic acid |
| InChIKey | QLDNIXIDTPFIOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC=N3)C(=N2)C(=O)O |
Computed by PubChem (NCBI)