cas: 1352998-96-9 — see every product listed under this CAS number, including other names
2–{((Benzyloxy)carbonyl)amino}–2–(naphthalen–2–yl)acetic acid (CAS 1352998-96-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54235-10g |
| cas | 1352998-96-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 10360.56 Pln | |
| GLPBio | 1g | 3297.69 Pln | |
| GLPBio | 2g | 4879.70 Pln | |
| GLPBio | 5g | 7116.98 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid (CAS 1352998-96-9) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: RERGEBQJCOXGBW-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | RERGEBQJCOXGBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(C2=CC3=CC=CC=C3C=C2)C(=O)O |
Computed by PubChem (NCBI)