Products 1352998-96-9
CAS 1352998-96-9 appears in our catalog under these names: 2-(((Benzyloxy)carbonyl)amino)-2-(naphthalen-2-yl)acetic acid, 98%, 2–{((Benzyloxy)carbonyl)amino}–2–(naphthalen–2–yl)acetic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 10g, 1g, 2g, 5g.
2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid (CAS 1352998-96-9) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: RERGEBQJCOXGBW-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-naphthalen-2-yl-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | RERGEBQJCOXGBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(C2=CC3=CC=CC=C3C=C2)C(=O)O |
Computed by PubChem (NCBI)