cas: 25178-38-5 — see every product listed under this CAS number, including other names
2–Amino–2–(2–hydroxyphenyl)acetic acid (CAS 25178-38-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF38047-100mg |
| cas | 25178-38-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 653.21 Pln | |
| GLPBio | 1g | 1739.08 Pln | |
| GLPBio | 250mg | 812.34 Pln | |
| GLPBio | 5g | 6522.55 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-2-(2-hydroxyphenyl)acetic acid (CAS 25178-38-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-2-(2-hydroxyphenyl)acetic acid. InChIKey: LIDYFNYBHXPTJG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-2-(2-hydroxyphenyl)acetic acid |
| InChIKey | LIDYFNYBHXPTJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)O |
Computed by PubChem (NCBI)