cas: 25178-38-5 — see every product listed under this CAS number, including other names
2-Amino-2-(2-hydroxyphenyl)acetic acid, 97% (CAS 25178-38-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091896-100MG |
| cas | 25178-38-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 893.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-2-(2-hydroxyphenyl)acetic acid (CAS 25178-38-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-2-(2-hydroxyphenyl)acetic acid. InChIKey: LIDYFNYBHXPTJG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-2-(2-hydroxyphenyl)acetic acid |
| InChIKey | LIDYFNYBHXPTJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)O |
Computed by PubChem (NCBI)