Products 25178-38-5
CAS 25178-38-5 appears in our catalog under these names: 2-Amino-2-(2-hydroxyphenyl)acetic acid, 95%, alpha-Amino-2-hydroxybenzeneacetic Acid, alpha-Amino-2-hydroxybenzeneacetic Acid Hydrochloride Salt (Technical Grade), 2–Amino–2–(2–hydroxyphenyl)acetic acid, H-DL-Phg(2-OH)-OH 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 500mg, 50mg, 100mg.
2-amino-2-(2-hydroxyphenyl)acetic acid (CAS 25178-38-5) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-2-(2-hydroxyphenyl)acetic acid. InChIKey: LIDYFNYBHXPTJG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-2-(2-hydroxyphenyl)acetic acid |
| InChIKey | LIDYFNYBHXPTJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)O |
Computed by PubChem (NCBI)