cas: 866633-25-2 — see every product listed under this CAS number, including other names
2–Bromo–4–fluoro–1–(trifluoromethoxy)benzene (CAS 866633-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF37168-100mg |
| cas | 866633-25-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 587.68 Pln | |
| GLPBio | 1g | 999.56 Pln | |
| GLPBio | 250mg | 671.93 Pln | |
| GLPBio | 5g | 2459.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-4-fluoro-1-(trifluoromethoxy)benzene (CAS 866633-25-2) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene. InChIKey: TUMXMNZWNKIGIE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene |
| InChIKey | TUMXMNZWNKIGIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC(F)(F)F |
Computed by PubChem (NCBI)