cas: 866633-25-2 — see every product listed under this CAS number, including other names
2-Bromo-4-fluoro-1-(trifluoromethoxy)benzene, 93% (CAS 866633-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094151-100MG |
| cas | 866633-25-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 612.30 Pln | |
| Fluorochem | 10g | 1169.40 Pln | |
| Fluorochem | 25g | 2288.80 Pln |
| purity | 93% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-fluoro-1-(trifluoromethoxy)benzene (CAS 866633-25-2) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene. InChIKey: TUMXMNZWNKIGIE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene |
| InChIKey | TUMXMNZWNKIGIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC(F)(F)F |
Computed by PubChem (NCBI)