cas: 121872-95-5 — see every product listed under this CAS number, including other names
2–Chloro–4,5–difluoro–benzoyl chloride (CAS 121872-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD08051-100g |
| cas | 121872-95-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 5043.51 Pln | |
| GLPBio | 1g | 536.19 Pln | |
| GLPBio | 25g | 1860.77 Pln | |
| GLPBio | 5g | 826.38 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-4,5-difluorobenzoyl chloride (CAS 121872-95-5) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 2-chloro-4,5-difluorobenzoyl chloride. InChIKey: WVGSPMZLNNRZRH-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 2-chloro-4,5-difluorobenzoyl chloride |
| InChIKey | WVGSPMZLNNRZRH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)