cas: 121872-95-5 — see every product listed under this CAS number, including other names
2-Chloro-4,5-difluorobenzoyl chloride, ≥95%, ≥95% (CAS 121872-95-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112781-1g |
| cas | 121872-95-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 25g | 1523.60 Pln | |
| Chemat | 100g | 4734.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4,5-difluorobenzoyl chloride (CAS 121872-95-5) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 2-chloro-4,5-difluorobenzoyl chloride. InChIKey: WVGSPMZLNNRZRH-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 2-chloro-4,5-difluorobenzoyl chloride |
| InChIKey | WVGSPMZLNNRZRH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)