cas: 108466-89-3 — see every product listed under this CAS number, including other names
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid, 97%, 97% (CAS 108466-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140XU-100mg |
| cas | 108466-89-3 |
| size | 100mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 50g | 640.40 Pln | |
| Chemat | 100g | 1202.00 Pln | |
| Chemat | 250g | 2440.40 Pln | |
| Chemat | 1kg | 7720.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid (CAS 108466-89-3) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid. InChIKey: OMBVJVWVXRNDSL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
| InChIKey | OMBVJVWVXRNDSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)