Products 660413-26-3
CAS 660413-26-3 appears in our catalog under these names: tert-Butyl 5-aminopentanoate oxalate(1:x) 95%, tert-Butyl 5-aminopentanoate oxalate(1:x), 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 5-aminopentanoate;oxalic acid (CAS 660413-26-3) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl 5-aminopentanoate;oxalic acid. InChIKey: ONEYSNZKNIVLPA-UHFFFAOYSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl 5-aminopentanoate;oxalic acid |
| InChIKey | ONEYSNZKNIVLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 5-aminopentanoate oxalate(1:x), ONEYSNZKNIVLPA-UHFFFAOYSA-N, tert-butyl 5-aminopentanoate oxalate, tert-Butyl 5-Aminopentanoate xOxalate, tert-butyl 5-aminopentanoate;oxalic acid, tert-butyl 5-aminopentanoate oxalic acid salt, Pentanoic acid, 5-amino-, 1,1-dimethylethyl ester, ethanedioate (1:)