CAS 108466-89-3 appears in our catalog under these names: 8-tert-Butyloxycarbonylamino-3,6-dioxaoctanoic Acid, Boc-O2Oc-OH, N-(tert-Butyloxycarbonyl)-8-amino-3,6-dioxaoctanoic acid, Boc-AEEA-OH 97%, 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid, 97%, 97%. Offered by: TRC, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 5g, 25g, 100g, 50g, 100mg, 250mg, 1g.
2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid (CAS 108466-89-3) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid. InChIKey: OMBVJVWVXRNDSL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
| InChIKey | OMBVJVWVXRNDSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)