CAS 130539-12-7 is the registry number for N-Boc-1,5-imino-1,5-dideoxy-D-glucitol. Offered by: Biosynth. Available pack sizes: 10mg.
Tert-butyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate (CAS 130539-12-7) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: QYBFXYKSDYOKTK-BZNPZCIMSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl (2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | QYBFXYKSDYOKTK-BZNPZCIMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O |
Computed by PubChem (NCBI)