CAS 122371-65-7 appears in our catalog under these names: tert-Butyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(hydroxymethyl)piperidine-1-carboxylate, 98%, N-Boc-1,5-imino-D-glucitol. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 25mg, 100mg, 50mg, 5 mg.
Tert-butyl (3R,4R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate (CAS 122371-65-7) is a chemical compound with the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl (3R,4R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: QYBFXYKSDYOKTK-GEPGNKONSA-N.
| Molecular formula | C11H21NO6 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | QYBFXYKSDYOKTK-GEPGNKONSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC([C@H]([C@@H](C1CO)O)O)O |
Computed by PubChem (NCBI)