cas: 6942-01-4 — see every product listed under this CAS number, including other names
2,2-diallyl-4,4-biphenol, 95%, 95% (CAS 6942-01-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143WR-250mg |
| cas | 6942-01-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol (CAS 6942-01-4) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol. InChIKey: CKKHZUOZFHWLIY-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol |
| InChIKey | CKKHZUOZFHWLIY-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C=CC(=C1)C2=CC(=C(C=C2)O)CC=C)O |
Computed by PubChem (NCBI)