CAS 81591-83-5 appears in our catalog under these names: 4,4'-Bis(oxiran-2-ylmethyl)-1,1'-biphenyl, 95%, 4,4'–Bis(oxiran–2–ylmethyl)–1,1'–biphenyl. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-[[4-[4-(oxiran-2-ylmethyl)phenyl]phenyl]methyl]oxirane (CAS 81591-83-5) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 2-[[4-[4-(oxiran-2-ylmethyl)phenyl]phenyl]methyl]oxirane. InChIKey: ZSAICLUIVSNXGW-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 2-[[4-[4-(oxiran-2-ylmethyl)phenyl]phenyl]methyl]oxirane |
| InChIKey | ZSAICLUIVSNXGW-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC2=CC=C(C=C2)C3=CC=C(C=C3)CC4CO4 |
Computed by PubChem (NCBI)