CAS 793-06-6 appears in our catalog under these names: 4,4'-Diacetylbibenzyl, 95%, 4,4′-Diacetylbibenzyl, 98%, 98%, 4,4'-Diacetylbibenzyl, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100g, 100mg, 10g, 50g.
1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone (CAS 793-06-6) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone. InChIKey: ZSLCVLSXAOHWBQ-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 1-[4-[2-(4-acetylphenyl)ethyl]phenyl]ethanone |
| InChIKey | ZSLCVLSXAOHWBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)CCC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)