CAS 1313738-05-4 is the registry number for Dienestrol-d4. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol (CAS 1313738-05-4) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol. InChIKey: NFDFQCUYFHCNBW-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
| InChIKey | NFDFQCUYFHCNBW-UHFFFAOYSA-N |
| SMILES | CC=C(C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)