CAS 6942-01-4 appears in our catalog under these names: 2,2-Diallyl-4,4-biphenol, 95%, 2,2–diallyl–4,4–biphenol, 2,2-diallyl-4,4-biphenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g.
4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol (CAS 6942-01-4) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol. InChIKey: CKKHZUOZFHWLIY-UHFFFAOYSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 4-(4-hydroxy-3-prop-2-enylphenyl)-2-prop-2-enylphenol |
| InChIKey | CKKHZUOZFHWLIY-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C=CC(=C1)C2=CC(=C(C=C2)O)CC=C)O |
Computed by PubChem (NCBI)