cas: 6921-22-8 — see every product listed under this CAS number, including other names
2,3-Difluoronitrobenzene, 98%, 98% (CAS 6921-22-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAFM-250mg |
| cas | 6921-22-8 |
| size | 250mg |
| availability | 54g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 640.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-difluoro-3-nitrobenzene (CAS 6921-22-8) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,2-difluoro-3-nitrobenzene. InChIKey: IXIJRPBFPLESEI-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,2-difluoro-3-nitrobenzene |
| InChIKey | IXIJRPBFPLESEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)