2-(((1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid 98%
cas: 94133-41-2 — see every product listed under this CAS number, including other names
2-(((1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid 98% (CAS 94133-41-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A758160-250mg |
| cas | 94133-41-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 3185.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A758160 |
2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid (CAS 94133-41-2) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid. InChIKey: CILPHQCEVYJUDN-AXFHLTTASA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-AXFHLTTASA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-[[(1S,2R,5S)-5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]acetic acid, 2-(((1S,2R,5S)-5-Methyl-2-(1-methylethyl)cyclohexyl)oxy)acetic acid, (+)-Menthyloxyacetic acid, 2-(((1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid, 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid, 2-{[(1S,2R,5S)-5-methyl-2-(propan-2-yl)cyclohexyl]oxy}acetic acid, (-)-Menthyloxyacetic acid, 2-[[(1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl]oxy]acetic Acid, (+)-Menthyloxyacetic acid, 98%, 2-[(1S,2R,5S)-2-isopropyl-5-methyl-cyclohexoxy]acetic acid