Products 40248-63-3
CAS 40248-63-3 appears in our catalog under these names: (-)-Menthoxyacetic acid, 98%, (–)–Menthyloxyacetic Acid, (-)-Menthoxyacetic Acid, >97.0%(GC)(T), (-)-Menthyloxyacetic acid 98%, 2-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100mg, 1 g, 5 g.
2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid (CAS 40248-63-3) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid. InChIKey: CILPHQCEVYJUDN-UHFFFAOYSA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
((5-Methyl-2-(1-methylethyl)cyclohexyl)oxy)acetic acid, 2-((5-Methyl-2-(1-methylethyl)cyclohexyl)oxy)acetic acid, (-)-Menthyloxyacetic acid, (-)-Menthoxyacetic acid, L-Menthoxyacetic acid, 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid, [(2-Isopropyl-5-methylcyclohexyl)oxy]acetic acid, (+)-Menthoxyacetic Acid, Levo-menthoxyacetic acid, 2-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}acetic acid