CAS 94133-41-2 appears in our catalog under these names: 2-(((1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid 98%, 2-[[(1S,2R,5S)-5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]acetic acid, 98%, 98%, (+)-Menthoxyacetic acid, 96%, (+)-Menthoxyacetic acid, 98%. Offered by: Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid (CAS 94133-41-2) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid. InChIKey: CILPHQCEVYJUDN-AXFHLTTASA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-AXFHLTTASA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)