Products 2813205-09-1

CAS 2813205-09-1 is the registry number for tert-Butyl 2,2-dimethyl-6-oxohexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Tert-butyl 2,2-dimethyl-6-oxohexanoate (CAS 2813205-09-1) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-6-oxohexanoate. InChIKey: LFTIPEHQSNDTNM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O3
Molecular weight214.30 g/mol
IUPAC nametert-butyl 2,2-dimethyl-6-oxohexanoate
InChIKeyLFTIPEHQSNDTNM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(C)(C)CCCC=O

Computed by PubChem (NCBI)