Products 71420-37-6

CAS 71420-37-6 is the registry number for [(2-Isopropyl-5-methylcyclohexyl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid (CAS 71420-37-6) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid. InChIKey: CILPHQCEVYJUDN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O3
Molecular weight214.30 g/mol
IUPAC name2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid
InChIKeyCILPHQCEVYJUDN-UHFFFAOYSA-N
SMILESCC1CCC(C(C1)OCC(=O)O)C(C)C

Computed by PubChem (NCBI)