cas: 3042-00-0 — see every product listed under this CAS number, including other names
2-((1H-Benzo[d]imidazol-2-yl)thio)acetic acid, 98%, 98% (CAS 3042-00-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11413Z-1g |
| cas | 3042-00-0 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 659.60 Pln | |
| Chemat | 25g | 2142.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(1H-benzimidazol-2-ylsulfanyl)acetic acid (CAS 3042-00-0) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylsulfanyl)acetic acid. InChIKey: UYNVBLJQBCTRKV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylsulfanyl)acetic acid |
| InChIKey | UYNVBLJQBCTRKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)SCC(=O)O |
Computed by PubChem (NCBI)