CAS 81864-47-3 is the registry number for 1,3,6,7-Tetrahydro-2h-[1,4]dioxino[2,3-f]benzimidazole-2-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3,6,7-tetrahydro-[1,4]dioxino[2,3-f]benzimidazole-2-thione (CAS 81864-47-3) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 1,3,6,7-tetrahydro-[1,4]dioxino[2,3-f]benzimidazole-2-thione. InChIKey: PMTXBVARJFBMAC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 1,3,6,7-tetrahydro-[1,4]dioxino[2,3-f]benzimidazole-2-thione |
| InChIKey | PMTXBVARJFBMAC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)NC(=S)N3 |
Computed by PubChem (NCBI)