CAS 23766-26-9 appears in our catalog under these names: 5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-thiol, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 5g, 1g, 250mg.
5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 23766-26-9) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: UGHZJAXROLHKEH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | UGHZJAXROLHKEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)