CAS 117324-16-0 is the registry number for Methyl 2-amino-5-(thiocyanato)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 2-amino-5-thiocyanatobenzoate (CAS 117324-16-0) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: methyl 2-amino-5-thiocyanatobenzoate. InChIKey: RGPZBRDJSOXWJT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | methyl 2-amino-5-thiocyanatobenzoate |
| InChIKey | RGPZBRDJSOXWJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)SC#N)N |
Computed by PubChem (NCBI)