CAS 871825-56-8 appears in our catalog under these names: 1-Methyl-3-thien-2-yl-1h-pyrazole-5-carboxylic acid, 95%, 1-Methyl-3-thien-2-yl-1H-pyrazole-5-carboxylic acid, 97% . Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 250MG.
1-methyl-3-thiophen-2-ylpyrazole-5-carboxylic acid (CAS 871825-56-8) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 1-methyl-3-thiophen-2-ylpyrazole-5-carboxylic acid. InChIKey: YSTOGMCNCZGBTG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 1-methyl-3-thiophen-2-ylpyrazole-5-carboxylic acid |
| InChIKey | YSTOGMCNCZGBTG-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)