cas: 114778-49-3 — see every product listed under this CAS number, including other names
2-((2,2-Dimethyl-1,3-dioxolan-4-yl)methoxy)isoindoline-1,3-dione, 95+% (CAS 114778-49-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A790072-5g |
| cas | 114778-49-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 37730.35 Pln | |
| AmBeed | 1g | 12595.24 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]isoindole-1,3-dione (CAS 114778-49-3) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]isoindole-1,3-dione. InChIKey: HOMXLUCZVUHMLW-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]isoindole-1,3-dione |
| InChIKey | HOMXLUCZVUHMLW-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)CON2C(=O)C3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)