Products 133749-60-7

CAS 133749-60-7 is the registry number for 1-[4-(Ethoxycarbonyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(4-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 133749-60-7) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: 1-(4-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: NPXFWULBRYXNLT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO5
Molecular weight277.27 g/mol
IUPAC name1-(4-ethoxycarbonylphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyNPXFWULBRYXNLT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)