CAS 107115-22-0 is the registry number for Methyl (2e)-2-cyano-3-(3,4,5-trimethoxyphenyl)acrylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (E)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CAS 107115-22-0) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: methyl (E)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate. InChIKey: YMKQWEVZPPOJHK-BJMVGYQFSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | methyl (E)-2-cyano-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| InChIKey | YMKQWEVZPPOJHK-BJMVGYQFSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C(\C#N)/C(=O)OC |
Computed by PubChem (NCBI)