cas: 1018295-42-5 — see every product listed under this CAS number, including other names
2-((2,6-DIFLUOROPHENYL)AMINO)-2-OXOACETIC ACID, 95% (CAS 1018295-42-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531215-100MG |
| cas | 1018295-42-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 216.61 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 2.5g | 581.06 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1783.76 Pln | |
| Fluorochem | 25g | 3751.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,6-difluoroanilino)-2-oxoacetic acid (CAS 1018295-42-5) is a chemical compound with the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. IUPAC name: 2-(2,6-difluoroanilino)-2-oxoacetic acid. InChIKey: XKMPHIMGYLKQKV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO3 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | 2-(2,6-difluoroanilino)-2-oxoacetic acid |
| InChIKey | XKMPHIMGYLKQKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=O)C(=O)O)F |
Computed by PubChem (NCBI)