CAS 1018295-42-5 appears in our catalog under these names: [(2,6-Difluorophenyl)carbamoyl]formic acid, 95%, 2,6–Difluoroanilino(oxo)acetic acid, 2,6-Difluoroanilino(oxo)acetic acid, 2-((2,6-Difluorophenyl)amino)-2-oxoacetic acid 97%, 2-((2,6-Difluorophenyl)Amino)-2-Oxoacetic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 100mg, 500mg.
2-(2,6-difluoroanilino)-2-oxoacetic acid (CAS 1018295-42-5) is a chemical compound with the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. IUPAC name: 2-(2,6-difluoroanilino)-2-oxoacetic acid. InChIKey: XKMPHIMGYLKQKV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO3 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | 2-(2,6-difluoroanilino)-2-oxoacetic acid |
| InChIKey | XKMPHIMGYLKQKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=O)C(=O)O)F |
Computed by PubChem (NCBI)