CAS 678556-81-5 is the registry number for [(2,4-Difluorophenyl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,4-difluoroanilino)-2-oxoacetic acid (CAS 678556-81-5) is a chemical compound with the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. IUPAC name: 2-(2,4-difluoroanilino)-2-oxoacetic acid. InChIKey: QTEWUHURLVWVJF-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO3 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | 2-(2,4-difluoroanilino)-2-oxoacetic acid |
| InChIKey | QTEWUHURLVWVJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)C(=O)O |
Computed by PubChem (NCBI)