Products 1060817-53-9

CAS 1060817-53-9 is the registry number for [(3,5-Difluorophenyl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-difluoroanilino)-2-oxoacetic acid (CAS 1060817-53-9) is a chemical compound with the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. IUPAC name: 2-(3,5-difluoroanilino)-2-oxoacetic acid. InChIKey: MHBVCCASECNRLD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F2NO3
Molecular weight201.13 g/mol
IUPAC name2-(3,5-difluoroanilino)-2-oxoacetic acid
InChIKeyMHBVCCASECNRLD-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)F)NC(=O)C(=O)O

Computed by PubChem (NCBI)