Products 83506-92-7
CAS 83506-92-7 is the registry number for 2-Carbamoyl-4,5-difluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-carbamoyl-4,5-difluorobenzoic acid (CAS 83506-92-7) is a chemical compound with the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. IUPAC name: 2-carbamoyl-4,5-difluorobenzoic acid. InChIKey: XEDVZAMDBUCGOM-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO3 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | 2-carbamoyl-4,5-difluorobenzoic acid |
| InChIKey | XEDVZAMDBUCGOM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)