cas: 530-75-6 — see every product listed under this CAS number, including other names
2-((2-Acetoxybenzoyl)oxy)benzoic acid, 97% (CAS 530-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 2.5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DAHT-100mg |
| cas | 530-75-6 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1686.80 Pln | |
| Chemat | 25g | 3746.00 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 2.5g | 987.17 Pln | |
| Fluorochem | 5g | 1273.53 Pln | |
| Fluorochem | 10g | 2169.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-acetyloxybenzoyl)oxybenzoic acid (CAS 530-75-6) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 2-(2-acetyloxybenzoyl)oxybenzoic acid. InChIKey: DDSFKIFGAPZBSR-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 2-(2-acetyloxybenzoyl)oxybenzoic acid |
| InChIKey | DDSFKIFGAPZBSR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)OC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)