2-((2-Aminophenyl)thio)benzoic acid, 95%
cas: 54920-98-8 — see every product listed under this CAS number, including other names
2-((2-Aminophenyl)thio)benzoic acid, 95% (CAS 54920-98-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A106184-100mg |
| cas | 54920-98-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 1021.19 Pln | |
| Ambeed | 1g | 2634.31 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 1003.00 Pln | |
| BLDpharm | 1g | 2585.78 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 2430.80 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1736.91 Pln | |
| Fluorochem | 1g | 4496.35 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-aminophenyl)sulfanylbenzoic acid (CAS 54920-98-8) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 2-(2-aminophenyl)sulfanylbenzoic acid. InChIKey: RMNTUOAOPRWVLP-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 2-(2-aminophenyl)sulfanylbenzoic acid |
| InChIKey | RMNTUOAOPRWVLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SC2=CC=CC=C2N |
Computed by PubChem (NCBI)
Synonyms:
2-((2-Aminophenyl)thio)benzoic acid, 2-[(2-Aminophenyl)thio]benzoic Acid, 2-(2-aminophenyl)sulfanylbenzoic Acid, 2-Amino-2-carboxydiphenylsulphide, Benzoic acid, 2-[(2-aminophenyl)thio]-, 2-(2-aminophenylthio)benzoic acid, 2-(2-Amino-phenylsulfanyl)-benzoic acid, 2-(2-Aminophenylsulfanyl)benzoic acid, RMNTUOAOPRWVLP-UHFFFAOYSA-N, 2-((2-Aminophenyl)thio)benzoicacid