CAS 2169-37-1 is the registry number for 9-Methanesulfonylcarbazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
9-methylsulfonylcarbazole (CAS 2169-37-1) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 9-methylsulfonylcarbazole. InChIKey: WANZPOQEQVYVEZ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 9-methylsulfonylcarbazole |
| InChIKey | WANZPOQEQVYVEZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C2=CC=CC=C2C3=CC=CC=C31 |
Computed by PubChem (NCBI)