CAS 100727-36-4 appears in our catalog under these names: 1-(Methylsulfanyl)-2-(4-nitrophenyl)benzene, 1-(Methylsulfanyl)-2-(4-nitrophenyl)benzene, 95%. Offered by: TRC, Combi-blocks. Available pack sizes: 500mg, 10g, 5g, 1g.
1-methylsulfanyl-2-(4-nitrophenyl)benzene (CAS 100727-36-4) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 1-methylsulfanyl-2-(4-nitrophenyl)benzene. InChIKey: CWBSWRVIZRRKMX-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 1-methylsulfanyl-2-(4-nitrophenyl)benzene |
| InChIKey | CWBSWRVIZRRKMX-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC=C1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)