Products 82145-82-2

CAS 82145-82-2 is the registry number for 4-((4-Pyridinylthio)methyl)benzoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-(pyridin-4-ylsulfanylmethyl)benzoic acid (CAS 82145-82-2) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 4-(pyridin-4-ylsulfanylmethyl)benzoic acid. InChIKey: XNNOJWYLAXLGSO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO2S
Molecular weight245.30 g/mol
IUPAC name4-(pyridin-4-ylsulfanylmethyl)benzoic acid
InChIKeyXNNOJWYLAXLGSO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CSC2=CC=NC=C2)C(=O)O

Computed by PubChem (NCBI)