Products 63185-86-4

CAS 63185-86-4 is the registry number for 5-Amino-2-(phenylthio)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-amino-2-phenylsulfanylbenzoic acid (CAS 63185-86-4) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 5-amino-2-phenylsulfanylbenzoic acid. InChIKey: MKSHKRLNPIFOSW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO2S
Molecular weight245.30 g/mol
IUPAC name5-amino-2-phenylsulfanylbenzoic acid
InChIKeyMKSHKRLNPIFOSW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SC2=C(C=C(C=C2)N)C(=O)O

Computed by PubChem (NCBI)