cas: 17689-42-8 — see every product listed under this CAS number, including other names
2-((2-Hydroxyethoxy)carbonyl)benzoic acid, ≥97%, ≥97% (CAS 17689-42-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135Y8-50mg |
| cas | 17689-42-8 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 170.00 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 100mg | 232.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(2-hydroxyethoxycarbonyl)benzoic acid (CAS 17689-42-8) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2-hydroxyethoxycarbonyl)benzoic acid. InChIKey: NTINFTOOVNKGIU-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(2-hydroxyethoxycarbonyl)benzoic acid |
| InChIKey | NTINFTOOVNKGIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)OCCO |
Computed by PubChem (NCBI)