cas: 17689-42-8 — see every product listed under this CAS number, including other names
2-((2-Hydroxyethoxy)carbonyl)benzoic acid, 97% (CAS 17689-42-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603224-1G |
| cas | 17689-42-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3012.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-hydroxyethoxycarbonyl)benzoic acid (CAS 17689-42-8) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2-hydroxyethoxycarbonyl)benzoic acid. InChIKey: NTINFTOOVNKGIU-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(2-hydroxyethoxycarbonyl)benzoic acid |
| InChIKey | NTINFTOOVNKGIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)OCCO |
Computed by PubChem (NCBI)