cas: 5246-57-1 — see every product listed under this CAS number, including other names
2-((3-Aminophenyl)sulfonyl)ethan-1-ol (CAS 5246-57-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F774384-250MG |
| cas | 5246-57-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2012.85 Pln |
| delivery time | 3-4 weeks |
|---|
2-(3-aminophenyl)sulfonylethanol (CAS 5246-57-1) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-(3-aminophenyl)sulfonylethanol. InChIKey: ASASRSMRAPYLQI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-(3-aminophenyl)sulfonylethanol |
| InChIKey | ASASRSMRAPYLQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CCO)N |
Computed by PubChem (NCBI)